C30H46ClFN2O — CID 143124932
(1S)-3-chloro-4-fluoro-N-methyl-N-[(1R,2S,5S,6S,9R,13R,16S)-6,7,13-trimethyl-7-azapentacyclo[10.8.0.02,9.05,9.013,18]icos-18-en-16-yl]cyclohexane-1-carboxamide (PubChem CID 143124932) has the molecular formula C30H46ClFN2O and a molecular weight of 505.16 g/mol. Its IUPAC name is (1S)-3-chloro-4-fluoro-N-methyl-N-[(1R,2S,5S,6S,9R,13R,16S)-6,7,13-trimethyl-7-azapentacyclo[10.8.0.02,9.05,9.013,18]icos-18-en-16-yl]cyclohexane-1-carboxamide.
| Compound Name | (1S)-3-chloro-4-fluoro-N-methyl-N-[(1R,2S,5S,6S,9R,13R,16S)-6,7,13-trimethyl-7-azapentacyclo[10.8.0.02,9.05,9.013,18]icos-18-en-16-yl]cyclohexane-1-carboxamide |
|---|---|
| PubChem CID | 143124932 |
| Molecular Formula | C30H46ClFN2O |
| Molecular Weight | 505.16 g/mol |
| Exact Mass | 504.33 |
| IUPAC Name | (1S)-3-chloro-4-fluoro-N-methyl-N-[(1R,2S,5S,6S,9R,13R,16S)-6,7,13-trimethyl-7-azapentacyclo[10.8.0.02,9.05,9.013,18]icos-18-en-16-yl]cyclohexane-1-carboxamide |
| SMILES | C[C@H]1[C@H]2CC[C@H]3[C@@H]4CC=C5C[C@@H](N(C)C(=O)[C@H]6CCC(F)C(Cl)C6)CC[C@]5(C)C4CC[C@]23CN1C |
| InChI | InChI=1S/C30H46ClFN2O/c1-18-23-8-9-25-22-7-6-20-16-21(34(4)28(35)19-5-10-27(32)26(31)15-19)11-13-29(20,2)24(22)12-14-30(23,25)17-33(18)3/h6,18-19,21-27H,5,7-17H2,1-4H3/t18-,19-,21-,22+,23+,24?,25-,26?,27?,29-,30-/m0/s1 |
| InChIKey | FNMWGLBUVIDEBN-XHCVOJARSA-N |
| XLogP | 6.45 |
| TPSA | 23.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 505.16 |
| LogP ≤ 5 | 6.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|