C29H48N2O2 — CID 67423562
2-hydroxy-N,4-dimethyl-N-(6,7,13-trimethyl-7-azapentacyclo[10.8.0.02,9.05,9.013,18]icos-18-en-16-yl)pentanamide (PubChem CID 67423562) has the molecular formula C29H48N2O2 and a molecular weight of 456.72 g/mol. Its IUPAC name is 2-hydroxy-N,4-dimethyl-N-(6,7,13-trimethyl-7-azapentacyclo[10.8.0.02,9.05,9.013,18]icos-18-en-16-yl)pentanamide.
| Compound Name | 2-hydroxy-N,4-dimethyl-N-(6,7,13-trimethyl-7-azapentacyclo[10.8.0.02,9.05,9.013,18]icos-18-en-16-yl)pentanamide |
|---|---|
| PubChem CID | 67423562 |
| Molecular Formula | C29H48N2O2 |
| Molecular Weight | 456.72 g/mol |
| Exact Mass | 456.37 |
| IUPAC Name | 2-hydroxy-N,4-dimethyl-N-(6,7,13-trimethyl-7-azapentacyclo[10.8.0.02,9.05,9.013,18]icos-18-en-16-yl)pentanamide |
| SMILES | CC(C)CC(O)C(=O)N(C)C1CCC2(C)C(=CCC3C2CCC24CN(C)C(C)C2CCC34)C1 |
| InChI | InChI=1S/C29H48N2O2/c1-18(2)15-26(32)27(33)31(6)21-11-13-28(4)20(16-21)7-8-22-24(28)12-14-29-17-30(5)19(3)23(29)9-10-25(22)29/h7,18-19,21-26,32H,8-17H2,1-6H3 |
| InChIKey | MLSJNLQBOFUBLU-UHFFFAOYSA-N |
| XLogP | 5.11 |
| TPSA | 43.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.72 |
| LogP ≤ 5 | 5.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|