C32H53N3O — CID 59678903
N-methyl-N-[(3R)-4-methyl-2-[methyl-[(1R,2S,5S,6S,13R,16S)-6,7,13-trimethyl-7-azapentacyclo[10.8.0.02,9.05,9.013,18]icos-18-en-16-yl]amino]pent-1-en-3-yl]acetamide (PubChem CID 59678903) has the molecular formula C32H53N3O and a molecular weight of 495.80 g/mol. Its IUPAC name is N-methyl-N-[(3R)-4-methyl-2-[methyl-[(1R,2S,5S,6S,13R,16S)-6,7,13-trimethyl-7-azapentacyclo[10.8.0.02,9.05,9.013,18]icos-18-en-16-yl]amino]pent-1-en-3-yl]acetamide.
| Compound Name | N-methyl-N-[(3R)-4-methyl-2-[methyl-[(1R,2S,5S,6S,13R,16S)-6,7,13-trimethyl-7-azapentacyclo[10.8.0.02,9.05,9.013,18]icos-18-en-16-yl]amino]pent-1-en-3-yl]acetamide |
|---|---|
| PubChem CID | 59678903 |
| Molecular Formula | C32H53N3O |
| Molecular Weight | 495.80 g/mol |
| Exact Mass | 495.42 |
| IUPAC Name | N-methyl-N-[(3R)-4-methyl-2-[methyl-[(1R,2S,5S,6S,13R,16S)-6,7,13-trimethyl-7-azapentacyclo[10.8.0.02,9.05,9.013,18]icos-18-en-16-yl]amino]pent-1-en-3-yl]acetamide |
| SMILES | C=C([C@@H](C(C)C)N(C)C(C)=O)N(C)[C@H]1CC[C@@]2(C)C(=CC[C@@H]3C2CCC24CN(C)[C@@H](C)[C@H]2CC[C@@H]34)C1 |
| InChI | InChI=1S/C32H53N3O/c1-20(2)30(35(9)23(5)36)22(4)34(8)25-14-16-31(6)24(18-25)10-11-26-28(31)15-17-32-19-33(7)21(3)27(32)12-13-29(26)32/h10,20-21,25-30H,4,11-19H2,1-3,5-9H3/t21-,25-,26+,27+,28?,29-,30+,31-,32?/m0/s1 |
| InChIKey | PRWTUEFSNNXKIW-BZIGUEFRSA-N |
| XLogP | 6.20 |
| TPSA | 26.79 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 495.80 |
| LogP ≤ 5 | 6.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|