C28H37NO4 — CID 59678892
[(1R,2S,5S,6S,9R,12S,13R,16S)-6,7,13-trimethyl-7-azapentacyclo[10.8.0.02,9.05,9.013,18]icos-18-en-16-yl] 2-(furan-2-yl)-2-oxoacetate (PubChem CID 59678892) has the molecular formula C28H37NO4 and a molecular weight of 451.61 g/mol. Its IUPAC name is [(1R,2S,5S,6S,9R,12S,13R,16S)-6,7,13-trimethyl-7-azapentacyclo[10.8.0.02,9.05,9.013,18]icos-18-en-16-yl] 2-(furan-2-yl)-2-oxoacetate.
| Compound Name | [(1R,2S,5S,6S,9R,12S,13R,16S)-6,7,13-trimethyl-7-azapentacyclo[10.8.0.02,9.05,9.013,18]icos-18-en-16-yl] 2-(furan-2-yl)-2-oxoacetate |
|---|---|
| PubChem CID | 59678892 |
| Molecular Formula | C28H37NO4 |
| Molecular Weight | 451.61 g/mol |
| Exact Mass | 451.27 |
| IUPAC Name | [(1R,2S,5S,6S,9R,12S,13R,16S)-6,7,13-trimethyl-7-azapentacyclo[10.8.0.02,9.05,9.013,18]icos-18-en-16-yl] 2-(furan-2-yl)-2-oxoacetate |
| SMILES | C[C@H]1[C@H]2CC[C@H]3[C@@H]4CC=C5C[C@@H](OC(=O)C(=O)c6ccco6)CC[C@]5(C)[C@H]4CC[C@]23CN1C |
| InChI | InChI=1S/C28H37NO4/c1-17-21-8-9-23-20-7-6-18-15-19(33-26(31)25(30)24-5-4-14-32-24)10-12-27(18,2)22(20)11-13-28(21,23)16-29(17)3/h4-6,14,17,19-23H,7-13,15-16H2,1-3H3/t17-,19-,20+,21+,22-,23-,27-,28-/m0/s1 |
| InChIKey | ZQCLCGBOOJEJNO-KDCQQXLUSA-N |
| XLogP | 5.27 |
| TPSA | 59.75 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.61 |
| LogP ≤ 5 | 5.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|