C29H38N2O5 — CID 143124893
(4-nitrophenyl) [(1R,5S,6S,9R,12S,13R,16S)-6,7,13-trimethyl-7-azapentacyclo[10.8.0.02,9.05,9.013,18]icos-18-en-16-yl] carbonate (PubChem CID 143124893) has the molecular formula C29H38N2O5 and a molecular weight of 494.63 g/mol. Its IUPAC name is (4-nitrophenyl) [(1R,5S,6S,9R,12S,13R,16S)-6,7,13-trimethyl-7-azapentacyclo[10.8.0.02,9.05,9.013,18]icos-18-en-16-yl] carbonate.
| Compound Name | (4-nitrophenyl) [(1R,5S,6S,9R,12S,13R,16S)-6,7,13-trimethyl-7-azapentacyclo[10.8.0.02,9.05,9.013,18]icos-18-en-16-yl] carbonate |
|---|---|
| PubChem CID | 143124893 |
| Molecular Formula | C29H38N2O5 |
| Molecular Weight | 494.63 g/mol |
| Exact Mass | 494.28 |
| IUPAC Name | (4-nitrophenyl) [(1R,5S,6S,9R,12S,13R,16S)-6,7,13-trimethyl-7-azapentacyclo[10.8.0.02,9.05,9.013,18]icos-18-en-16-yl] carbonate |
| SMILES | C[C@H]1[C@H]2CCC3[C@@H]4CC=C5C[C@@H](OC(=O)Oc6ccc([N+](=O)[O-])cc6)CC[C@]5(C)[C@H]4CC[C@@]32CN1C |
| InChI | InChI=1S/C29H38N2O5/c1-18-24-10-11-26-23-9-4-19-16-22(36-27(32)35-21-7-5-20(6-8-21)31(33)34)12-14-28(19,2)25(23)13-15-29(24,26)17-30(18)3/h4-8,18,22-26H,9-17H2,1-3H3/t18-,22-,23+,24+,25-,26?,28-,29-/m0/s1 |
| InChIKey | DHPOWGRLXPQREU-KYGPTBRJSA-N |
| XLogP | 6.37 |
| TPSA | 81.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 494.63 |
| LogP ≤ 5 | 6.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phenyl_carbonate', 'substructure': 'N/A'} |
|---|