C27H39N3O2S — CID 11634176
1,3-thiazol-5-ylmethyl N-[(1R,2S,5S,6S,9R,13R,16S)-6,7,13-trimethyl-7-azapentacyclo[10.8.0.02,9.05,9.013,18]icos-18-en-16-yl]carbamate (PubChem CID 11634176) has the molecular formula C27H39N3O2S and a molecular weight of 469.70 g/mol. Its IUPAC name is 1,3-thiazol-5-ylmethyl N-[(1R,2S,5S,6S,9R,13R,16S)-6,7,13-trimethyl-7-azapentacyclo[10.8.0.02,9.05,9.013,18]icos-18-en-16-yl]carbamate.
| Compound Name | 1,3-thiazol-5-ylmethyl N-[(1R,2S,5S,6S,9R,13R,16S)-6,7,13-trimethyl-7-azapentacyclo[10.8.0.02,9.05,9.013,18]icos-18-en-16-yl]carbamate |
|---|---|
| PubChem CID | 11634176 |
| Molecular Formula | C27H39N3O2S |
| Molecular Weight | 469.70 g/mol |
| Exact Mass | 469.28 |
| IUPAC Name | 1,3-thiazol-5-ylmethyl N-[(1R,2S,5S,6S,9R,13R,16S)-6,7,13-trimethyl-7-azapentacyclo[10.8.0.02,9.05,9.013,18]icos-18-en-16-yl]carbamate |
| SMILES | C[C@H]1[C@H]2CC[C@H]3[C@@H]4CC=C5C[C@@H](NC(=O)OCc6cncs6)CC[C@]5(C)C4CC[C@]23CN1C |
| InChI | InChI=1S/C27H39N3O2S/c1-17-22-6-7-24-21-5-4-18-12-19(29-25(31)32-14-20-13-28-16-33-20)8-10-26(18,2)23(21)9-11-27(22,24)15-30(17)3/h4,13,16-17,19,21-24H,5-12,14-15H2,1-3H3,(H,29,31)/t17-,19-,21+,22+,23?,24-,26-,27-/m0/s1 |
| InChIKey | IMLXNXRUUJCWPG-SOULYQKTSA-N |
| XLogP | 5.63 |
| TPSA | 54.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 469.70 |
| LogP ≤ 5 | 5.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|