C30H45N3O2S — CID 143124936
1,3-thiazol-5-ylmethyl N-[(1R,2S,5S,6S,12S,13S)-6,7-dimethyl-13-propan-2-yl-7-azapentacyclo[10.8.0.02,9.05,9.013,18]icos-18-en-16-yl]-N-methylcarbamate (PubChem CID 143124936) has the molecular formula C30H45N3O2S and a molecular weight of 511.78 g/mol. Its IUPAC name is 1,3-thiazol-5-ylmethyl N-[(1R,2S,5S,6S,12S,13S)-6,7-dimethyl-13-propan-2-yl-7-azapentacyclo[10.8.0.02,9.05,9.013,18]icos-18-en-16-yl]-N-methylcarbamate.
| Compound Name | 1,3-thiazol-5-ylmethyl N-[(1R,2S,5S,6S,12S,13S)-6,7-dimethyl-13-propan-2-yl-7-azapentacyclo[10.8.0.02,9.05,9.013,18]icos-18-en-16-yl]-N-methylcarbamate |
|---|---|
| PubChem CID | 143124936 |
| Molecular Formula | C30H45N3O2S |
| Molecular Weight | 511.78 g/mol |
| Exact Mass | 511.32 |
| IUPAC Name | 1,3-thiazol-5-ylmethyl N-[(1R,2S,5S,6S,12S,13S)-6,7-dimethyl-13-propan-2-yl-7-azapentacyclo[10.8.0.02,9.05,9.013,18]icos-18-en-16-yl]-N-methylcarbamate |
| SMILES | CC(C)[C@]12CCC(N(C)C(=O)OCc3cncs3)CC1=CC[C@H]1[C@@H]3CC[C@@H]4[C@H](C)N(C)CC43CC[C@@H]12 |
| InChI | InChI=1S/C30H45N3O2S/c1-19(2)30-13-10-22(33(5)28(34)35-16-23-15-31-18-36-23)14-21(30)6-7-24-26-9-8-25-20(3)32(4)17-29(25,26)12-11-27(24)30/h6,15,18-20,22,24-27H,7-14,16-17H2,1-5H3/t20-,22?,24-,25+,26-,27-,29?,30+/m0/s1 |
| InChIKey | INGYGSVPQHJBDQ-YRJWBJROSA-N |
| XLogP | 6.61 |
| TPSA | 45.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 511.78 |
| LogP ≤ 5 | 6.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|