C23H32F3NO2 — CID 15838726
N-[(3S,8S,9S,10R,13S,14S,17S)-17-acetyl-10,13-dimethyl-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-3-yl]-2,2,2-trifluoroacetamide (PubChem CID 15838726) has the molecular formula C23H32F3NO2 and a molecular weight of 411.51 g/mol. Its IUPAC name is N-[(3S,8S,9S,10R,13S,14S,17S)-17-acetyl-10,13-dimethyl-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-3-yl]-2,2,2-trifluoroacetamide.
| Compound Name | N-[(3S,8S,9S,10R,13S,14S,17S)-17-acetyl-10,13-dimethyl-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-3-yl]-2,2,2-trifluoroacetamide |
|---|---|
| PubChem CID | 15838726 |
| Molecular Formula | C23H32F3NO2 |
| Molecular Weight | 411.51 g/mol |
| Exact Mass | 411.24 |
| IUPAC Name | N-[(3S,8S,9S,10R,13S,14S,17S)-17-acetyl-10,13-dimethyl-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-3-yl]-2,2,2-trifluoroacetamide |
| SMILES | CC(=O)[C@H]1CC[C@H]2[C@@H]3CC=C4C[C@@H](NC(=O)C(F)(F)F)CC[C@]4(C)[C@H]3CC[C@]12C |
| InChI | InChI=1S/C23H32F3NO2/c1-13(28)17-6-7-18-16-5-4-14-12-15(27-20(29)23(24,25)26)8-10-21(14,2)19(16)9-11-22(17,18)3/h4,15-19H,5-12H2,1-3H3,(H,27,29)/t15-,16-,17+,18-,19-,21-,22+/m0/s1 |
| InChIKey | YWDADMBNYFHDLM-KAFUMNDRSA-N |
| XLogP | 5.20 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.51 |
| LogP ≤ 5 | 5.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|