C27H43NO2 — CID 163427341
tert-butyl N-[(3R,10R,13S,17R)-10,13-dimethyl-17-prop-1-en-2-yl-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-3-yl]carbamate (PubChem CID 163427341) has the molecular formula C27H43NO2 and a molecular weight of 413.65 g/mol. Its IUPAC name is tert-butyl N-[(3R,10R,13S,17R)-10,13-dimethyl-17-prop-1-en-2-yl-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-3-yl]carbamate.
| Compound Name | tert-butyl N-[(3R,10R,13S,17R)-10,13-dimethyl-17-prop-1-en-2-yl-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-3-yl]carbamate |
|---|---|
| PubChem CID | 163427341 |
| Molecular Formula | C27H43NO2 |
| Molecular Weight | 413.65 g/mol |
| Exact Mass | 413.33 |
| IUPAC Name | tert-butyl N-[(3R,10R,13S,17R)-10,13-dimethyl-17-prop-1-en-2-yl-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-3-yl]carbamate |
| SMILES | C=C(C)[C@H]1CCC2C3CC=C4C[C@H](NC(=O)OC(C)(C)C)CC[C@]4(C)C3CC[C@@]21C |
| InChI | InChI=1S/C27H43NO2/c1-17(2)21-10-11-22-20-9-8-18-16-19(28-24(29)30-25(3,4)5)12-14-26(18,6)23(20)13-15-27(21,22)7/h8,19-23H,1,9-16H2,2-7H3,(H,28,29)/t19-,20?,21-,22?,23?,26+,27-/m1/s1 |
| InChIKey | ANQWJCNUZDOREE-PAGZKWLKSA-N |
| XLogP | 7.03 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.65 |
| LogP ≤ 5 | 7.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|