C22H31NO — CID 166979629
17-acetyl-10,13-dimethyl-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthrene-3-carbonitrile (PubChem CID 166979629) has the molecular formula C22H31NO and a molecular weight of 325.50 g/mol. Its IUPAC name is 17-acetyl-10,13-dimethyl-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthrene-3-carbonitrile.
| Compound Name | 17-acetyl-10,13-dimethyl-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthrene-3-carbonitrile |
|---|---|
| PubChem CID | 166979629 |
| Molecular Formula | C22H31NO |
| Molecular Weight | 325.50 g/mol |
| Exact Mass | 325.24 |
| IUPAC Name | 17-acetyl-10,13-dimethyl-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthrene-3-carbonitrile |
| SMILES | CC(=O)C1CCC2C3CC=C4CC(C#N)CCC4(C)C3CCC12C |
| InChI | InChI=1S/C22H31NO/c1-14(24)18-6-7-19-17-5-4-16-12-15(13-23)8-10-21(16,2)20(17)9-11-22(18,19)3/h4,15,17-20H,5-12H2,1-3H3 |
| InChIKey | QETVUMCGFGQMBN-UHFFFAOYSA-N |
| XLogP | 5.29 |
| TPSA | 40.86 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.50 |
| LogP ≤ 5 | 5.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|