C21H31NO6Se — CID 132918849
methyl (2R)-3-benzylselanyl-2-[bis[(2-methylpropan-2-yl)oxycarbonyl]amino]propanoate (PubChem CID 132918849) has the molecular formula C21H31NO6Se and a molecular weight of 472.44 g/mol. Its IUPAC name is methyl (2R)-3-benzylselanyl-2-[bis[(2-methylpropan-2-yl)oxycarbonyl]amino]propanoate.
| Compound Name | methyl (2R)-3-benzylselanyl-2-[bis[(2-methylpropan-2-yl)oxycarbonyl]amino]propanoate |
|---|---|
| PubChem CID | 132918849 |
| Molecular Formula | C21H31NO6Se |
| Molecular Weight | 472.44 g/mol |
| Exact Mass | 473.13 |
| IUPAC Name | methyl (2R)-3-benzylselanyl-2-[bis[(2-methylpropan-2-yl)oxycarbonyl]amino]propanoate |
| SMILES | COC(=O)[C@H](C[Se]Cc1ccccc1)N(C(=O)OC(C)(C)C)C(=O)OC(C)(C)C |
| InChI | InChI=1S/C21H31NO6Se/c1-20(2,3)27-18(24)22(19(25)28-21(4,5)6)16(17(23)26-7)14-29-13-15-11-9-8-10-12-15/h8-12,16H,13-14H2,1-7H3/t16-/m0/s1 |
| InChIKey | WAEDXYCTNNALGF-INIZCTEOSA-N |
| XLogP | 4.02 |
| TPSA | 82.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.44 |
| LogP ≤ 5 | 4.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|