C14H14FNO2 — CID 132919328
7-fluorospiro[2H-1-benzofuran-3,3'-cyclohexene]-4-carboxamide (PubChem CID 132919328) has the molecular formula C14H14FNO2 and a molecular weight of 247.27 g/mol. Its IUPAC name is 7-fluorospiro[2H-1-benzofuran-3,3'-cyclohexene]-4-carboxamide.
| Compound Name | 7-fluorospiro[2H-1-benzofuran-3,3'-cyclohexene]-4-carboxamide |
|---|---|
| PubChem CID | 132919328 |
| Molecular Formula | C14H14FNO2 |
| Molecular Weight | 247.27 g/mol |
| Exact Mass | 247.10 |
| IUPAC Name | 7-fluorospiro[2H-1-benzofuran-3,3'-cyclohexene]-4-carboxamide |
| SMILES | NC(=O)c1ccc(F)c2c1C1(C=CCCC1)CO2 |
| InChI | InChI=1S/C14H14FNO2/c15-10-5-4-9(13(16)17)11-12(10)18-8-14(11)6-2-1-3-7-14/h2,4-6H,1,3,7-8H2,(H2,16,17) |
| InChIKey | BNZIMMYLDUIJJI-UHFFFAOYSA-N |
| XLogP | 2.29 |
| TPSA | 52.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 247.27 |
| LogP ≤ 5 | 2.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|