C36H44Cl4N2 — CID 132930640
N-benzyl-N-[3-[4-[3-[benzyl(5-chloropentyl)amino]prop-1-ynyl]phenyl]prop-2-ynyl]-5-chloropentan-1-amine;dihydrochloride (PubChem CID 132930640) has the molecular formula C36H44Cl4N2 and a molecular weight of 646.57 g/mol. Its IUPAC name is N-benzyl-N-[3-[4-[3-[benzyl(5-chloropentyl)amino]prop-1-ynyl]phenyl]prop-2-ynyl]-5-chloropentan-1-amine;dihydrochloride.
| Compound Name | N-benzyl-N-[3-[4-[3-[benzyl(5-chloropentyl)amino]prop-1-ynyl]phenyl]prop-2-ynyl]-5-chloropentan-1-amine;dihydrochloride |
|---|---|
| PubChem CID | 132930640 |
| Molecular Formula | C36H44Cl4N2 |
| Molecular Weight | 646.57 g/mol |
| Exact Mass | 644.23 |
| IUPAC Name | N-benzyl-N-[3-[4-[3-[benzyl(5-chloropentyl)amino]prop-1-ynyl]phenyl]prop-2-ynyl]-5-chloropentan-1-amine;dihydrochloride |
| SMILES | Cl.Cl.ClCCCCCN(CC#Cc1ccc(C#CCN(CCCCCCl)Cc2ccccc2)cc1)Cc1ccccc1 |
| InChI | InChI=1S/C36H42Cl2N2.2ClH/c37-25-9-3-11-27-39(31-35-15-5-1-6-16-35)29-13-19-33-21-23-34(24-22-33)20-14-30-40(28-12-4-10-26-38)32-36-17-7-2-8-18-36;;/h1-2,5-8,15-18,21-24H,3-4,9-12,25-32H2;2*1H |
| InChIKey | GFWFEYUFYAHSBR-UHFFFAOYSA-N |
| XLogP | 9.06 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 646.57 |
| LogP ≤ 5 | 9.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|