About CID 132933176
CID 132933176 (PubChem CID 132933176) has the molecular formula C10H16BrMgS
and a molecular weight of 272.51 g/mol.
Molecular Properties
| Compound Name | CID 132933176 |
| PubChem CID | 132933176 |
| Molecular Formula | C10H16BrMgS |
| Molecular Weight | 272.51 g/mol |
| Exact Mass | 271.00 |
| IUPAC Name | — |
| SMILES | CCCCCCc1c[c]sc1Br.[H][H].[Mg] |
| InChI | InChI=1S/C10H14BrS.Mg.H2/c1-2-3-4-5-6-9-7-8-12-10(9)11;;/h7H,2-6H2,1H3;;1H |
| InChIKey | ZVUVPEHWPRSSSX-UHFFFAOYSA-N |
| XLogP | 4.30 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 272.51 |
| LogP ≤ 5 | 4.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze CID 132933176 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 132933176?
The IUPAC name of CID 132933176 (CID 132933176) is not available.
What is the SMILES notation for CID 132933176?
The canonical SMILES for CID 132933176 is CCCCCCc1c[c]sc1Br.[H][H].[Mg].
What is the InChIKey of CID 132933176?
The InChIKey is ZVUVPEHWPRSSSX-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H14BrS.Mg.H2/c1-2-3-4-5-6-9-7-8-12-10(9)11;;/h7H,2-6H2,1H3;;1H.
What are the key properties of CID 132933176?
CID 132933176 has a molecular weight of 272.51 g/mol, XLogP of 4.30, 5 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for CID 132933176 is sourced from PubChem (CID 132933176), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).