C16H16F2O3S — CID 132933234
(1S,2S,5R,6R,7R)-5-[difluoro(phenylsulfanyl)methyl]-5-hydroxy-4-oxatricyclo[5.2.1.02,6]decan-3-one (PubChem CID 132933234) has the molecular formula C16H16F2O3S and a molecular weight of 326.36 g/mol. Its IUPAC name is (1S,2S,5R,6R,7R)-5-[difluoro(phenylsulfanyl)methyl]-5-hydroxy-4-oxatricyclo[5.2.1.02,6]decan-3-one.
| Compound Name | (1S,2S,5R,6R,7R)-5-[difluoro(phenylsulfanyl)methyl]-5-hydroxy-4-oxatricyclo[5.2.1.02,6]decan-3-one |
|---|---|
| PubChem CID | 132933234 |
| Molecular Formula | C16H16F2O3S |
| Molecular Weight | 326.36 g/mol |
| Exact Mass | 326.08 |
| IUPAC Name | (1S,2S,5R,6R,7R)-5-[difluoro(phenylsulfanyl)methyl]-5-hydroxy-4-oxatricyclo[5.2.1.02,6]decan-3-one |
| SMILES | O=C1O[C@@](O)(C(F)(F)Sc2ccccc2)[C@@H]2[C@@H]3CC[C@@H](C3)[C@H]12 |
| InChI | InChI=1S/C16H16F2O3S/c17-16(18,22-11-4-2-1-3-5-11)15(20)13-10-7-6-9(8-10)12(13)14(19)21-15/h1-5,9-10,12-13,20H,6-8H2/t9-,10+,12-,13+,15+/m0/s1 |
| InChIKey | FEZAIXMWEIDYAR-DPXGPQMFSA-N |
| XLogP | 3.28 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.36 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |