C20H24F2O2S — CID 132933235
(1S,2S,5S,6R,7R)-5-butyl-5-[difluoro(phenylsulfanyl)methyl]-4-oxatricyclo[5.2.1.02,6]decan-3-one (PubChem CID 132933235) has the molecular formula C20H24F2O2S and a molecular weight of 366.47 g/mol. Its IUPAC name is (1S,2S,5S,6R,7R)-5-butyl-5-[difluoro(phenylsulfanyl)methyl]-4-oxatricyclo[5.2.1.02,6]decan-3-one.
| Compound Name | (1S,2S,5S,6R,7R)-5-butyl-5-[difluoro(phenylsulfanyl)methyl]-4-oxatricyclo[5.2.1.02,6]decan-3-one |
|---|---|
| PubChem CID | 132933235 |
| Molecular Formula | C20H24F2O2S |
| Molecular Weight | 366.47 g/mol |
| Exact Mass | 366.15 |
| IUPAC Name | (1S,2S,5S,6R,7R)-5-butyl-5-[difluoro(phenylsulfanyl)methyl]-4-oxatricyclo[5.2.1.02,6]decan-3-one |
| SMILES | CCCC[C@]1(C(F)(F)Sc2ccccc2)OC(=O)[C@H]2[C@H]3CC[C@H](C3)[C@H]21 |
| InChI | InChI=1S/C20H24F2O2S/c1-2-3-11-19(20(21,22)25-15-7-5-4-6-8-15)17-14-10-9-13(12-14)16(17)18(23)24-19/h4-8,13-14,16-17H,2-3,9-12H2,1H3/t13-,14+,16-,17+,19-/m0/s1 |
| InChIKey | BPTQHKRTJIWXKY-JLFGJHNZSA-N |
| XLogP | 5.52 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.47 |
| LogP ≤ 5 | 5.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |