C16H14F2O3S — CID 139094087
(1R,2S,5R,6R,7S)-5-[difluoro(phenylsulfanyl)methyl]-5-hydroxy-4-oxatricyclo[5.2.1.02,6]dec-8-en-3-one (PubChem CID 139094087) has the molecular formula C16H14F2O3S and a molecular weight of 324.35 g/mol. Its IUPAC name is (1R,2S,5R,6R,7S)-5-[difluoro(phenylsulfanyl)methyl]-5-hydroxy-4-oxatricyclo[5.2.1.02,6]dec-8-en-3-one.
| Compound Name | (1R,2S,5R,6R,7S)-5-[difluoro(phenylsulfanyl)methyl]-5-hydroxy-4-oxatricyclo[5.2.1.02,6]dec-8-en-3-one |
|---|---|
| PubChem CID | 139094087 |
| Molecular Formula | C16H14F2O3S |
| Molecular Weight | 324.35 g/mol |
| Exact Mass | 324.06 |
| IUPAC Name | (1R,2S,5R,6R,7S)-5-[difluoro(phenylsulfanyl)methyl]-5-hydroxy-4-oxatricyclo[5.2.1.02,6]dec-8-en-3-one |
| SMILES | O=C1O[C@@](O)(C(F)(F)Sc2ccccc2)[C@H]2[C@@H]1[C@H]1C=C[C@@H]2C1 |
| InChI | InChI=1S/C16H14F2O3S/c17-16(18,22-11-4-2-1-3-5-11)15(20)13-10-7-6-9(8-10)12(13)14(19)21-15/h1-7,9-10,12-13,20H,8H2/t9-,10+,12-,13+,15+/m0/s1 |
| InChIKey | GNQVMVVRLSPSDU-DPXGPQMFSA-N |
| XLogP | 3.06 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.35 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|