C17H14N4O2S — CID 132933487
2'-(4-methylphenyl)-5-sulfanylidenespiro[1,2,4-triazolidine-3,4'-isoquinoline]-1',3'-dione (PubChem CID 132933487) has the molecular formula C17H14N4O2S and a molecular weight of 338.39 g/mol. Its IUPAC name is 2'-(4-methylphenyl)-5-sulfanylidenespiro[1,2,4-triazolidine-3,4'-isoquinoline]-1',3'-dione.
| Compound Name | 2'-(4-methylphenyl)-5-sulfanylidenespiro[1,2,4-triazolidine-3,4'-isoquinoline]-1',3'-dione |
|---|---|
| PubChem CID | 132933487 |
| Molecular Formula | C17H14N4O2S |
| Molecular Weight | 338.39 g/mol |
| Exact Mass | 338.08 |
| IUPAC Name | 2'-(4-methylphenyl)-5-sulfanylidenespiro[1,2,4-triazolidine-3,4'-isoquinoline]-1',3'-dione |
| SMILES | Cc1ccc(N2C(=O)c3ccccc3C3(NNC(=S)N3)C2=O)cc1 |
| InChI | InChI=1S/C17H14N4O2S/c1-10-6-8-11(9-7-10)21-14(22)12-4-2-3-5-13(12)17(15(21)23)18-16(24)19-20-17/h2-9,20H,1H3,(H2,18,19,24) |
| InChIKey | JNGUUBBNSQFJLH-UHFFFAOYSA-N |
| XLogP | 1.32 |
| TPSA | 73.47 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.39 |
| LogP ≤ 5 | 1.32 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|