C12H23NO — CID 132936784
2-[[(2E)-2,7-dimethylocta-2,7-dienyl]amino]ethanol (PubChem CID 132936784) has the molecular formula C12H23NO and a molecular weight of 197.32 g/mol. Its IUPAC name is 2-[[(2E)-2,7-dimethylocta-2,7-dienyl]amino]ethanol.
| Compound Name | 2-[[(2E)-2,7-dimethylocta-2,7-dienyl]amino]ethanol |
|---|---|
| PubChem CID | 132936784 |
| Molecular Formula | C12H23NO |
| Molecular Weight | 197.32 g/mol |
| Exact Mass | 197.18 |
| IUPAC Name | 2-[[(2E)-2,7-dimethylocta-2,7-dienyl]amino]ethanol |
| SMILES | C=C(C)CCC/C=C(\C)CNCCO |
| InChI | InChI=1S/C12H23NO/c1-11(2)6-4-5-7-12(3)10-13-8-9-14/h7,13-14H,1,4-6,8-10H2,2-3H3/b12-7+ |
| InChIKey | CJJNYBHCWWQUQB-KPKJPENVSA-N |
| XLogP | 2.26 |
| TPSA | 32.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 197.32 |
| LogP ≤ 5 | 2.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|