C12H20O — CID 6437671
(4E)-5,9-dimethyldeca-4,9-dienal (PubChem CID 6437671) has the molecular formula C12H20O and a molecular weight of 180.29 g/mol. Its IUPAC name is (4E)-5,9-dimethyldeca-4,9-dienal.
| Compound Name | (4E)-5,9-dimethyldeca-4,9-dienal |
|---|---|
| PubChem CID | 6437671 |
| Molecular Formula | C12H20O |
| Molecular Weight | 180.29 g/mol |
| Exact Mass | 180.15 |
| IUPAC Name | (4E)-5,9-dimethyldeca-4,9-dienal |
| SMILES | C=C(C)CCC/C(C)=C/CCC=O |
| InChI | InChI=1S/C12H20O/c1-11(2)7-6-9-12(3)8-4-5-10-13/h8,10H,1,4-7,9H2,2-3H3/b12-8+ |
| InChIKey | ABDPYMYJZBDRKL-XYOKQWHBSA-N |
| XLogP | 3.66 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 180.29 |
| LogP ≤ 5 | 3.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|