C22H28N2O7 — CID 132937142
methyl 3-[(8R)-8-ethyl-2,8a-dimethoxy-1-(2-nitrophenyl)-3-oxo-6,7-dihydro-5H-indolizin-8-yl]propanoate (PubChem CID 132937142) has the molecular formula C22H28N2O7 and a molecular weight of 432.47 g/mol. Its IUPAC name is methyl 3-[(8R)-8-ethyl-2,8a-dimethoxy-1-(2-nitrophenyl)-3-oxo-6,7-dihydro-5H-indolizin-8-yl]propanoate.
| Compound Name | methyl 3-[(8R)-8-ethyl-2,8a-dimethoxy-1-(2-nitrophenyl)-3-oxo-6,7-dihydro-5H-indolizin-8-yl]propanoate |
|---|---|
| PubChem CID | 132937142 |
| Molecular Formula | C22H28N2O7 |
| Molecular Weight | 432.47 g/mol |
| Exact Mass | 432.19 |
| IUPAC Name | methyl 3-[(8R)-8-ethyl-2,8a-dimethoxy-1-(2-nitrophenyl)-3-oxo-6,7-dihydro-5H-indolizin-8-yl]propanoate |
| SMILES | CC[C@]1(CCC(=O)OC)CCCN2C(=O)C(OC)=C(c3ccccc3[N+](=O)[O-])C21OC |
| InChI | InChI=1S/C22H28N2O7/c1-5-21(13-11-17(25)29-2)12-8-14-23-20(26)19(30-3)18(22(21,23)31-4)15-9-6-7-10-16(15)24(27)28/h6-7,9-10H,5,8,11-14H2,1-4H3/t21-,22?/m1/s1 |
| InChIKey | RZBLZVNMNUXSOG-ZMFCMNQTSA-N |
| XLogP | 3.28 |
| TPSA | 108.21 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.47 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|