C20H24N2O4 — CID 102106872
methyl 3-[1-(2-aminophenyl)-8-ethenyl-8a-hydroxy-3-oxo-6,7-dihydro-5H-indolizin-8-yl]propanoate (PubChem CID 102106872) has the molecular formula C20H24N2O4 and a molecular weight of 356.42 g/mol. Its IUPAC name is methyl 3-[1-(2-aminophenyl)-8-ethenyl-8a-hydroxy-3-oxo-6,7-dihydro-5H-indolizin-8-yl]propanoate.
| Compound Name | methyl 3-[1-(2-aminophenyl)-8-ethenyl-8a-hydroxy-3-oxo-6,7-dihydro-5H-indolizin-8-yl]propanoate |
|---|---|
| PubChem CID | 102106872 |
| Molecular Formula | C20H24N2O4 |
| Molecular Weight | 356.42 g/mol |
| Exact Mass | 356.17 |
| IUPAC Name | methyl 3-[1-(2-aminophenyl)-8-ethenyl-8a-hydroxy-3-oxo-6,7-dihydro-5H-indolizin-8-yl]propanoate |
| SMILES | C=CC1(CCC(=O)OC)CCCN2C(=O)C=C(c3ccccc3N)C21O |
| InChI | InChI=1S/C20H24N2O4/c1-3-19(11-9-18(24)26-2)10-6-12-22-17(23)13-15(20(19,22)25)14-7-4-5-8-16(14)21/h3-5,7-8,13,25H,1,6,9-12,21H2,2H3 |
| InChIKey | RCNBDKYNEHUJIZ-UHFFFAOYSA-N |
| XLogP | 2.10 |
| TPSA | 92.86 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.42 |
| LogP ≤ 5 | 2.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|