C19H18N2O4S — CID 132937584
3-methylidene-1-(4-methylphenyl)sulfonyl-5-(4-nitrophenyl)-2,4-dihydropyridine (PubChem CID 132937584) has the molecular formula C19H18N2O4S and a molecular weight of 370.43 g/mol. Its IUPAC name is 3-methylidene-1-(4-methylphenyl)sulfonyl-5-(4-nitrophenyl)-2,4-dihydropyridine.
| Compound Name | 3-methylidene-1-(4-methylphenyl)sulfonyl-5-(4-nitrophenyl)-2,4-dihydropyridine |
|---|---|
| PubChem CID | 132937584 |
| Molecular Formula | C19H18N2O4S |
| Molecular Weight | 370.43 g/mol |
| Exact Mass | 370.10 |
| IUPAC Name | 3-methylidene-1-(4-methylphenyl)sulfonyl-5-(4-nitrophenyl)-2,4-dihydropyridine |
| SMILES | C=C1CC(c2ccc([N+](=O)[O-])cc2)=CN(S(=O)(=O)c2ccc(C)cc2)C1 |
| InChI | InChI=1S/C19H18N2O4S/c1-14-3-9-19(10-4-14)26(24,25)20-12-15(2)11-17(13-20)16-5-7-18(8-6-16)21(22)23/h3-10,13H,2,11-12H2,1H3 |
| InChIKey | NGDJORKCWNXORZ-UHFFFAOYSA-N |
| XLogP | 3.89 |
| TPSA | 80.52 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.43 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|