C22H22O4 — CID 132938400
(4Z,6Z)-2-methoxy-2-methyl-4,6-bis[(4-methylphenyl)methylidene]-1,3-dioxan-5-one (PubChem CID 132938400) has the molecular formula C22H22O4 and a molecular weight of 350.41 g/mol. Its IUPAC name is (4Z,6Z)-2-methoxy-2-methyl-4,6-bis[(4-methylphenyl)methylidene]-1,3-dioxan-5-one.
| Compound Name | (4Z,6Z)-2-methoxy-2-methyl-4,6-bis[(4-methylphenyl)methylidene]-1,3-dioxan-5-one |
|---|---|
| PubChem CID | 132938400 |
| Molecular Formula | C22H22O4 |
| Molecular Weight | 350.41 g/mol |
| Exact Mass | 350.15 |
| IUPAC Name | (4Z,6Z)-2-methoxy-2-methyl-4,6-bis[(4-methylphenyl)methylidene]-1,3-dioxan-5-one |
| SMILES | COC1(C)O/C(=C\c2ccc(C)cc2)C(=O)/C(=C/c2ccc(C)cc2)O1 |
| InChI | InChI=1S/C22H22O4/c1-15-5-9-17(10-6-15)13-19-21(23)20(26-22(3,24-4)25-19)14-18-11-7-16(2)8-12-18/h5-14H,1-4H3/b19-13-,20-14- |
| InChIKey | SLVAGBFKKTWNLJ-AXPXABNXSA-N |
| XLogP | 4.62 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.41 |
| LogP ≤ 5 | 4.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'ene_one_ene_A(57)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|