C18H22O4 — CID 132938649
ethyl (3S)-3-(dimethoxymethyl)-2-methylidene-6-phenylhex-5-ynoate (PubChem CID 132938649) has the molecular formula C18H22O4 and a molecular weight of 302.37 g/mol. Its IUPAC name is ethyl (3S)-3-(dimethoxymethyl)-2-methylidene-6-phenylhex-5-ynoate.
| Compound Name | ethyl (3S)-3-(dimethoxymethyl)-2-methylidene-6-phenylhex-5-ynoate |
|---|---|
| PubChem CID | 132938649 |
| Molecular Formula | C18H22O4 |
| Molecular Weight | 302.37 g/mol |
| Exact Mass | 302.15 |
| IUPAC Name | ethyl (3S)-3-(dimethoxymethyl)-2-methylidene-6-phenylhex-5-ynoate |
| SMILES | C=C(C(=O)OCC)[C@H](CC#Cc1ccccc1)C(OC)OC |
| InChI | InChI=1S/C18H22O4/c1-5-22-17(19)14(2)16(18(20-3)21-4)13-9-12-15-10-7-6-8-11-15/h6-8,10-11,16,18H,2,5,13H2,1,3-4H3/t16-/m0/s1 |
| InChIKey | AQGHRTDLZGXTHL-INIZCTEOSA-N |
| XLogP | 2.78 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.37 |
| LogP ≤ 5 | 2.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|