About ethyl 3-[[2-ethenylidenepentyl-(4-methylphenyl)sulfonylamino]methyl]-5-methylhexa-3,4-dienoate
ethyl 3-[[2-ethenylidenepentyl-(4-methylphenyl)sulfonylamino]methyl]-5-methylhexa-3,4-dienoate (PubChem CID 132938921) has the molecular formula C24H33NO4S
and a molecular weight of 431.60 g/mol. Its IUPAC name is ethyl 3-[[2-ethenylidenepentyl-(4-methylphenyl)sulfonylamino]methyl]-5-methylhexa-3,4-dienoate.
Molecular Properties
| Compound Name | ethyl 3-[[2-ethenylidenepentyl-(4-methylphenyl)sulfonylamino]methyl]-5-methylhexa-3,4-dienoate |
| PubChem CID | 132938921 |
| Molecular Formula | C24H33NO4S |
| Molecular Weight | 431.60 g/mol |
| Exact Mass | 431.21 |
| IUPAC Name | ethyl 3-[[2-ethenylidenepentyl-(4-methylphenyl)sulfonylamino]methyl]-5-methylhexa-3,4-dienoate |
| SMILES | C=C=C(CCC)CN(CC(=C=C(C)C)CC(=O)OCC)S(=O)(=O)c1ccc(C)cc1 |
| InChI | InChI=1S/C24H33NO4S/c1-7-10-21(8-2)17-25(30(27,28)23-13-11-20(6)12-14-23)18-22(15-19(4)5)16-24(26)29-9-3/h11-14H,2,7,9-10,16-18H2,1,3-6H3 |
| InChIKey | FWKBFKIYMKYMCV-UHFFFAOYSA-N |
| XLogP | 4.94 |
| TPSA | 63.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 30 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 431.60 |
| LogP ≤ 5 | 4.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze ethyl 3-[[2-ethenylidenepentyl-(4-methylphenyl)sulfonylamino]methyl]-5-methylhexa-3,4-dienoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl 3-[[2-ethenylidenepentyl-(4-methylphenyl)sulfonylamino]methyl]-5-methylhexa-3,4-dienoate?
The IUPAC name of ethyl 3-[[2-ethenylidenepentyl-(4-methylphenyl)sulfonylamino]methyl]-5-methylhexa-3,4-dienoate (CID 132938921) is ethyl 3-[[2-ethenylidenepentyl-(4-methylphenyl)sulfonylamino]methyl]-5-methylhexa-3,4-dienoate.
What is the SMILES notation for ethyl 3-[[2-ethenylidenepentyl-(4-methylphenyl)sulfonylamino]methyl]-5-methylhexa-3,4-dienoate?
The canonical SMILES for ethyl 3-[[2-ethenylidenepentyl-(4-methylphenyl)sulfonylamino]methyl]-5-methylhexa-3,4-dienoate is C=C=C(CCC)CN(CC(=C=C(C)C)CC(=O)OCC)S(=O)(=O)c1ccc(C)cc1.
What is the InChIKey of ethyl 3-[[2-ethenylidenepentyl-(4-methylphenyl)sulfonylamino]methyl]-5-methylhexa-3,4-dienoate?
The InChIKey is FWKBFKIYMKYMCV-UHFFFAOYSA-N. The full InChI is InChI=1S/C24H33NO4S/c1-7-10-21(8-2)17-25(30(27,28)23-13-11-20(6)12-14-23)18-22(15-19(4)5)16-24(26)29-9-3/h11-14H,2,7,9-10,16-18H2,1,3-6H3.
What are the key properties of ethyl 3-[[2-ethenylidenepentyl-(4-methylphenyl)sulfonylamino]methyl]-5-methylhexa-3,4-dienoate?
ethyl 3-[[2-ethenylidenepentyl-(4-methylphenyl)sulfonylamino]methyl]-5-methylhexa-3,4-dienoate has a molecular weight of 431.60 g/mol, XLogP of 4.94, 11 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl 3-[[2-ethenylidenepentyl-(4-methylphenyl)sulfonylamino]methyl]-5-methylhexa-3,4-dienoate is sourced from PubChem (CID 132938921), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).