C21H22N2O — CID 132962052
(1S,2S,3R,4S)-3-(9H-fluoren-9-ylamino)bicyclo[2.2.1]heptane-2-carboxamide (PubChem CID 132962052) has the molecular formula C21H22N2O and a molecular weight of 318.42 g/mol. Its IUPAC name is (1S,2S,3R,4S)-3-(9H-fluoren-9-ylamino)bicyclo[2.2.1]heptane-2-carboxamide.
| Compound Name | (1S,2S,3R,4S)-3-(9H-fluoren-9-ylamino)bicyclo[2.2.1]heptane-2-carboxamide |
|---|---|
| PubChem CID | 132962052 |
| Molecular Formula | C21H22N2O |
| Molecular Weight | 318.42 g/mol |
| Exact Mass | 318.17 |
| IUPAC Name | (1S,2S,3R,4S)-3-(9H-fluoren-9-ylamino)bicyclo[2.2.1]heptane-2-carboxamide |
| SMILES | NC(=O)[C@H]1[C@H]2CC[C@@H](C2)[C@H]1NC1c2ccccc2-c2ccccc21 |
| InChI | InChI=1S/C21H22N2O/c22-21(24)18-12-9-10-13(11-12)19(18)23-20-16-7-3-1-5-14(16)15-6-2-4-8-17(15)20/h1-8,12-13,18-20,23H,9-11H2,(H2,22,24)/t12-,13-,18-,19+/m0/s1 |
| InChIKey | YMXWXCIXEVAVNC-BIPCEHGGSA-N |
| XLogP | 3.25 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.42 |
| LogP ≤ 5 | 3.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |