C20H20ClNO4 — CID 132969674
prop-2-enyl (2R)-2-(3-chlorophenyl)-3-(phenylmethoxycarbonylamino)propanoate (PubChem CID 132969674) has the molecular formula C20H20ClNO4 and a molecular weight of 373.84 g/mol. Its IUPAC name is prop-2-enyl (2R)-2-(3-chlorophenyl)-3-(phenylmethoxycarbonylamino)propanoate.
| Compound Name | prop-2-enyl (2R)-2-(3-chlorophenyl)-3-(phenylmethoxycarbonylamino)propanoate |
|---|---|
| PubChem CID | 132969674 |
| Molecular Formula | C20H20ClNO4 |
| Molecular Weight | 373.84 g/mol |
| Exact Mass | 373.11 |
| IUPAC Name | prop-2-enyl (2R)-2-(3-chlorophenyl)-3-(phenylmethoxycarbonylamino)propanoate |
| SMILES | C=CCOC(=O)[C@@H](CNC(=O)OCc1ccccc1)c1cccc(Cl)c1 |
| InChI | InChI=1S/C20H20ClNO4/c1-2-11-25-19(23)18(16-9-6-10-17(21)12-16)13-22-20(24)26-14-15-7-4-3-5-8-15/h2-10,12,18H,1,11,13-14H2,(H,22,24)/t18-/m0/s1 |
| InChIKey | KCMNFFUJJMSVDC-SFHVURJKSA-N |
| XLogP | 4.08 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.84 |
| LogP ≤ 5 | 4.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|