C15H10N2O2 — CID 132969704
1-imidazo[1,2-a]pyridin-3-yl-2-phenylethane-1,2-dione (PubChem CID 132969704) has the molecular formula C15H10N2O2 and a molecular weight of 250.26 g/mol. Its IUPAC name is 1-imidazo[1,2-a]pyridin-3-yl-2-phenylethane-1,2-dione.
| Compound Name | 1-imidazo[1,2-a]pyridin-3-yl-2-phenylethane-1,2-dione |
|---|---|
| PubChem CID | 132969704 |
| Molecular Formula | C15H10N2O2 |
| Molecular Weight | 250.26 g/mol |
| Exact Mass | 250.07 |
| IUPAC Name | 1-imidazo[1,2-a]pyridin-3-yl-2-phenylethane-1,2-dione |
| SMILES | O=C(C(=O)c1cnc2ccccn12)c1ccccc1 |
| InChI | InChI=1S/C15H10N2O2/c18-14(11-6-2-1-3-7-11)15(19)12-10-16-13-8-4-5-9-17(12)13/h1-10H |
| InChIKey | NXXUZOTXJSOOLT-UHFFFAOYSA-N |
| XLogP | 2.40 |
| TPSA | 51.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.26 |
| LogP ≤ 5 | 2.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|