C22H22FNO5 — CID 132986983
N-ethyl-2-[4-[(E)-(7-fluoro-4-hydroxy-1-methyl-3-oxo-1H-inden-2-ylidene)methyl]-2-methoxyphenoxy]acetamide (PubChem CID 132986983) has the molecular formula C22H22FNO5 and a molecular weight of 399.42 g/mol. Its IUPAC name is N-ethyl-2-[4-[(E)-(7-fluoro-4-hydroxy-1-methyl-3-oxo-1H-inden-2-ylidene)methyl]-2-methoxyphenoxy]acetamide.
| Compound Name | N-ethyl-2-[4-[(E)-(7-fluoro-4-hydroxy-1-methyl-3-oxo-1H-inden-2-ylidene)methyl]-2-methoxyphenoxy]acetamide |
|---|---|
| PubChem CID | 132986983 |
| Molecular Formula | C22H22FNO5 |
| Molecular Weight | 399.42 g/mol |
| Exact Mass | 399.15 |
| IUPAC Name | N-ethyl-2-[4-[(E)-(7-fluoro-4-hydroxy-1-methyl-3-oxo-1H-inden-2-ylidene)methyl]-2-methoxyphenoxy]acetamide |
| SMILES | CCNC(=O)COc1ccc(/C=C2/C(=O)c3c(O)ccc(F)c3C2C)cc1OC |
| InChI | InChI=1S/C22H22FNO5/c1-4-24-19(26)11-29-17-8-5-13(10-18(17)28-3)9-14-12(2)20-15(23)6-7-16(25)21(20)22(14)27/h5-10,12,25H,4,11H2,1-3H3,(H,24,26)/b14-9+ |
| InChIKey | OZCVCZKTXWCIFD-NTEUORMPSA-N |
| XLogP | 3.44 |
| TPSA | 84.86 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.42 |
| LogP ≤ 5 | 3.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|