C9H14N2O4 — CID 132990410
ethyl N-(2-oxo-4-prop-1-en-2-yl-1,3-oxazolidin-3-yl)carbamate (PubChem CID 132990410) has the molecular formula C9H14N2O4 and a molecular weight of 214.22 g/mol. Its IUPAC name is ethyl N-(2-oxo-4-prop-1-en-2-yl-1,3-oxazolidin-3-yl)carbamate.
| Compound Name | ethyl N-(2-oxo-4-prop-1-en-2-yl-1,3-oxazolidin-3-yl)carbamate |
|---|---|
| PubChem CID | 132990410 |
| Molecular Formula | C9H14N2O4 |
| Molecular Weight | 214.22 g/mol |
| Exact Mass | 214.10 |
| IUPAC Name | ethyl N-(2-oxo-4-prop-1-en-2-yl-1,3-oxazolidin-3-yl)carbamate |
| SMILES | C=C(C)C1COC(=O)N1NC(=O)OCC |
| InChI | InChI=1S/C9H14N2O4/c1-4-14-8(12)10-11-7(6(2)3)5-15-9(11)13/h7H,2,4-5H2,1,3H3,(H,10,12) |
| InChIKey | FRFHAOGFSFQFGN-UHFFFAOYSA-N |
| XLogP | 1.04 |
| TPSA | 67.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 214.22 |
| LogP ≤ 5 | 1.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|