C11H14F3NO3 — CID 163522003
(4S)-4-prop-1-en-2-yl-3-(5,5,5-trifluoropentanoyl)-1,3-oxazolidin-2-one (PubChem CID 163522003) has the molecular formula C11H14F3NO3 and a molecular weight of 265.23 g/mol. Its IUPAC name is (4S)-4-prop-1-en-2-yl-3-(5,5,5-trifluoropentanoyl)-1,3-oxazolidin-2-one.
| Compound Name | (4S)-4-prop-1-en-2-yl-3-(5,5,5-trifluoropentanoyl)-1,3-oxazolidin-2-one |
|---|---|
| PubChem CID | 163522003 |
| Molecular Formula | C11H14F3NO3 |
| Molecular Weight | 265.23 g/mol |
| Exact Mass | 265.09 |
| IUPAC Name | (4S)-4-prop-1-en-2-yl-3-(5,5,5-trifluoropentanoyl)-1,3-oxazolidin-2-one |
| SMILES | C=C(C)[C@H]1COC(=O)N1C(=O)CCCC(F)(F)F |
| InChI | InChI=1S/C11H14F3NO3/c1-7(2)8-6-18-10(17)15(8)9(16)4-3-5-11(12,13)14/h8H,1,3-6H2,2H3/t8-/m1/s1 |
| InChIKey | DLQAFDVOXSSYQV-MRVPVSSYSA-N |
| XLogP | 2.64 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.23 |
| LogP ≤ 5 | 2.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|