C22H26N4O2 — CID 132990718
8-ethyl-1,3-diphenyl-8a-propan-2-yl-6,7-dihydroimidazo[1,2-a][1,3,5]triazine-2,4-dione (PubChem CID 132990718) has the molecular formula C22H26N4O2 and a molecular weight of 378.48 g/mol. Its IUPAC name is 8-ethyl-1,3-diphenyl-8a-propan-2-yl-6,7-dihydroimidazo[1,2-a][1,3,5]triazine-2,4-dione.
| Compound Name | 8-ethyl-1,3-diphenyl-8a-propan-2-yl-6,7-dihydroimidazo[1,2-a][1,3,5]triazine-2,4-dione |
|---|---|
| PubChem CID | 132990718 |
| Molecular Formula | C22H26N4O2 |
| Molecular Weight | 378.48 g/mol |
| Exact Mass | 378.21 |
| IUPAC Name | 8-ethyl-1,3-diphenyl-8a-propan-2-yl-6,7-dihydroimidazo[1,2-a][1,3,5]triazine-2,4-dione |
| SMILES | CCN1CCN2C(=O)N(c3ccccc3)C(=O)N(c3ccccc3)C12C(C)C |
| InChI | InChI=1S/C22H26N4O2/c1-4-23-15-16-24-20(27)25(18-11-7-5-8-12-18)21(28)26(22(23,24)17(2)3)19-13-9-6-10-14-19/h5-14,17H,4,15-16H2,1-3H3 |
| InChIKey | BQBJASUDXSRGBF-UHFFFAOYSA-N |
| XLogP | 4.20 |
| TPSA | 47.10 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.48 |
| LogP ≤ 5 | 4.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |