C27H31ClN2O5 — CID 132992876
ethyl 2-(2-chloroacetyl)-4-(3-methoxy-4-propoxyphenyl)-1-methyl-4,9-dihydro-3H-pyrido[3,4-b]indole-1-carboxylate (PubChem CID 132992876) has the molecular formula C27H31ClN2O5 and a molecular weight of 499.01 g/mol. Its IUPAC name is ethyl 2-(2-chloroacetyl)-4-(3-methoxy-4-propoxyphenyl)-1-methyl-4,9-dihydro-3H-pyrido[3,4-b]indole-1-carboxylate.
| Compound Name | ethyl 2-(2-chloroacetyl)-4-(3-methoxy-4-propoxyphenyl)-1-methyl-4,9-dihydro-3H-pyrido[3,4-b]indole-1-carboxylate |
|---|---|
| PubChem CID | 132992876 |
| Molecular Formula | C27H31ClN2O5 |
| Molecular Weight | 499.01 g/mol |
| Exact Mass | 498.19 |
| IUPAC Name | ethyl 2-(2-chloroacetyl)-4-(3-methoxy-4-propoxyphenyl)-1-methyl-4,9-dihydro-3H-pyrido[3,4-b]indole-1-carboxylate |
| SMILES | CCCOc1ccc(C2CN(C(=O)CCl)C(C)(C(=O)OCC)c3[nH]c4ccccc4c32)cc1OC |
| InChI | InChI=1S/C27H31ClN2O5/c1-5-13-35-21-12-11-17(14-22(21)33-4)19-16-30(23(31)15-28)27(3,26(32)34-6-2)25-24(19)18-9-7-8-10-20(18)29-25/h7-12,14,19,29H,5-6,13,15-16H2,1-4H3 |
| InChIKey | PGYRJPUXBDVEQD-UHFFFAOYSA-N |
| XLogP | 4.96 |
| TPSA | 80.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 499.01 |
| LogP ≤ 5 | 4.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|