C12H10F6 — CID 13300003
7-propan-2-ylidene-2,3-bis(trifluoromethyl)bicyclo[2.2.1]hepta-2,5-diene (PubChem CID 13300003) has the molecular formula C12H10F6 and a molecular weight of 268.20 g/mol. Its IUPAC name is 7-propan-2-ylidene-2,3-bis(trifluoromethyl)bicyclo[2.2.1]hepta-2,5-diene.
| Compound Name | 7-propan-2-ylidene-2,3-bis(trifluoromethyl)bicyclo[2.2.1]hepta-2,5-diene |
|---|---|
| PubChem CID | 13300003 |
| Molecular Formula | C12H10F6 |
| Molecular Weight | 268.20 g/mol |
| Exact Mass | 268.07 |
| IUPAC Name | 7-propan-2-ylidene-2,3-bis(trifluoromethyl)bicyclo[2.2.1]hepta-2,5-diene |
| SMILES | CC(C)=C1C2C=CC1C(C(F)(F)F)=C2C(F)(F)F |
| InChI | InChI=1S/C12H10F6/c1-5(2)8-6-3-4-7(8)10(12(16,17)18)9(6)11(13,14)15/h3-4,6-7H,1-2H3 |
| InChIKey | FIUGRIKKBXFKJH-UHFFFAOYSA-N |
| XLogP | 4.56 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.20 |
| LogP ≤ 5 | 4.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|