C17H15N3OS — CID 13301021
(7-methylsulfanyl-1,8,10-triazatricyclo[7.3.0.02,6]dodeca-2(6),7,9,11-tetraen-11-yl)-phenylmethanone (PubChem CID 13301021) has the molecular formula C17H15N3OS and a molecular weight of 309.39 g/mol. Its IUPAC name is (7-methylsulfanyl-1,8,10-triazatricyclo[7.3.0.02,6]dodeca-2(6),7,9,11-tetraen-11-yl)-phenylmethanone.
| Compound Name | (7-methylsulfanyl-1,8,10-triazatricyclo[7.3.0.02,6]dodeca-2(6),7,9,11-tetraen-11-yl)-phenylmethanone |
|---|---|
| PubChem CID | 13301021 |
| Molecular Formula | C17H15N3OS |
| Molecular Weight | 309.39 g/mol |
| Exact Mass | 309.09 |
| IUPAC Name | (7-methylsulfanyl-1,8,10-triazatricyclo[7.3.0.02,6]dodeca-2(6),7,9,11-tetraen-11-yl)-phenylmethanone |
| SMILES | CSc1nc2nc(C(=O)c3ccccc3)cn2c2c1CCC2 |
| InChI | InChI=1S/C17H15N3OS/c1-22-16-12-8-5-9-14(12)20-10-13(18-17(20)19-16)15(21)11-6-3-2-4-7-11/h2-4,6-7,10H,5,8-9H2,1H3 |
| InChIKey | VMTWSAUQINTQKM-UHFFFAOYSA-N |
| XLogP | 3.17 |
| TPSA | 47.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.39 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |