About 1-adamantyl-dimethyl-phenylsilane
1-adamantyl-dimethyl-phenylsilane (PubChem CID 13303229) has the molecular formula C18H26Si
and a molecular weight of 270.49 g/mol. Its IUPAC name is 1-adamantyl-dimethyl-phenylsilane.
Molecular Properties
| Compound Name | 1-adamantyl-dimethyl-phenylsilane |
| PubChem CID | 13303229 |
| Molecular Formula | C18H26Si |
| Molecular Weight | 270.49 g/mol |
| Exact Mass | 270.18 |
| IUPAC Name | 1-adamantyl-dimethyl-phenylsilane |
| SMILES | C[Si](C)(c1ccccc1)C12CC3CC(CC(C3)C1)C2 |
| InChI | InChI=1S/C18H26Si/c1-19(2,17-6-4-3-5-7-17)18-11-14-8-15(12-18)10-16(9-14)13-18/h3-7,14-16H,8-13H2,1-2H3 |
| InChIKey | NQEAAQPILYINOO-UHFFFAOYSA-N |
| XLogP | 4.57 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 270.49 |
| LogP ≤ 5 | 4.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze 1-adamantyl-dimethyl-phenylsilane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-adamantyl-dimethyl-phenylsilane?
The IUPAC name of 1-adamantyl-dimethyl-phenylsilane (CID 13303229) is 1-adamantyl-dimethyl-phenylsilane.
What is the SMILES notation for 1-adamantyl-dimethyl-phenylsilane?
The canonical SMILES for 1-adamantyl-dimethyl-phenylsilane is C[Si](C)(c1ccccc1)C12CC3CC(CC(C3)C1)C2.
What is the InChIKey of 1-adamantyl-dimethyl-phenylsilane?
The InChIKey is NQEAAQPILYINOO-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H26Si/c1-19(2,17-6-4-3-5-7-17)18-11-14-8-15(12-18)10-16(9-14)13-18/h3-7,14-16H,8-13H2,1-2H3.
What are the key properties of 1-adamantyl-dimethyl-phenylsilane?
1-adamantyl-dimethyl-phenylsilane has a molecular weight of 270.49 g/mol, XLogP of 4.57, 2 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 1-adamantyl-dimethyl-phenylsilane is sourced from PubChem (CID 13303229), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).