About 1-benzyladamantane
1-benzyladamantane (PubChem CID 584912) has the molecular formula C17H22
and a molecular weight of 226.36 g/mol. Its IUPAC name is 1-benzyladamantane.
Molecular Properties
| Compound Name | 1-benzyladamantane |
| PubChem CID | 584912 |
| Molecular Formula | C17H22 |
| Molecular Weight | 226.36 g/mol |
| Exact Mass | 226.17 |
| IUPAC Name | 1-benzyladamantane |
| SMILES | c1ccc(CC23CC4CC(CC(C4)C2)C3)cc1 |
| InChI | InChI=1S/C17H22/c1-2-4-13(5-3-1)9-17-10-14-6-15(11-17)8-16(7-14)12-17/h1-5,14-16H,6-12H2 |
| InChIKey | OFLIQILVJSTLDM-UHFFFAOYSA-N |
| XLogP | 4.45 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 226.36 |
| LogP ≤ 5 | 4.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Analyze 1-benzyladamantane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-benzyladamantane?
The IUPAC name of 1-benzyladamantane (CID 584912) is 1-benzyladamantane.
What is the SMILES notation for 1-benzyladamantane?
The canonical SMILES for 1-benzyladamantane is c1ccc(CC23CC4CC(CC(C4)C2)C3)cc1.
What is the InChIKey of 1-benzyladamantane?
The InChIKey is OFLIQILVJSTLDM-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H22/c1-2-4-13(5-3-1)9-17-10-14-6-15(11-17)8-16(7-14)12-17/h1-5,14-16H,6-12H2.
What are the key properties of 1-benzyladamantane?
1-benzyladamantane has a molecular weight of 226.36 g/mol, XLogP of 4.45, 2 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 1-benzyladamantane is sourced from PubChem (CID 584912), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).