C21H26Cl3N3O11S — CID 133052771
[3,4,5-trihydroxy-6-[2,4,6-trichloro-3-[2-[imidazole-1-carbonyl(propyl)amino]ethoxy]phenoxy]oxan-2-yl]methyl hydrogen sulfate (PubChem CID 133052771) has the molecular formula C21H26Cl3N3O11S and a molecular weight of 634.88 g/mol. Its IUPAC name is [3,4,5-trihydroxy-6-[2,4,6-trichloro-3-[2-[imidazole-1-carbonyl(propyl)amino]ethoxy]phenoxy]oxan-2-yl]methyl hydrogen sulfate.
| Compound Name | [3,4,5-trihydroxy-6-[2,4,6-trichloro-3-[2-[imidazole-1-carbonyl(propyl)amino]ethoxy]phenoxy]oxan-2-yl]methyl hydrogen sulfate |
|---|---|
| PubChem CID | 133052771 |
| Molecular Formula | C21H26Cl3N3O11S |
| Molecular Weight | 634.88 g/mol |
| Exact Mass | 633.04 |
| IUPAC Name | [3,4,5-trihydroxy-6-[2,4,6-trichloro-3-[2-[imidazole-1-carbonyl(propyl)amino]ethoxy]phenoxy]oxan-2-yl]methyl hydrogen sulfate |
| SMILES | CCCN(CCOc1c(Cl)cc(Cl)c(OC2OC(COS(=O)(=O)O)C(O)C(O)C2O)c1Cl)C(=O)n1ccnc1 |
| InChI | InChI=1S/C21H26Cl3N3O11S/c1-2-4-26(21(31)27-5-3-25-10-27)6-7-35-18-11(22)8-12(23)19(14(18)24)38-20-17(30)16(29)15(28)13(37-20)9-36-39(32,33)34/h3,5,8,10,13,15-17,20,28-30H,2,4,6-7,9H2,1H3,(H,32,33,34) |
| InChIKey | UNCSXZRCRHPBJA-UHFFFAOYSA-N |
| XLogP | 1.61 |
| TPSA | 190.11 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 634.88 |
| LogP ≤ 5 | 1.61 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|