C8H11BrN2O — CID 133056820
6-bromo-4-methoxy-N,N-dimethylpyridin-2-amine (PubChem CID 133056820) has the molecular formula C8H11BrN2O and a molecular weight of 231.09 g/mol. Its IUPAC name is 6-bromo-4-methoxy-N,N-dimethylpyridin-2-amine.
| Compound Name | 6-bromo-4-methoxy-N,N-dimethylpyridin-2-amine |
|---|---|
| PubChem CID | 133056820 |
| Molecular Formula | C8H11BrN2O |
| Molecular Weight | 231.09 g/mol |
| Exact Mass | 230.01 |
| IUPAC Name | 6-bromo-4-methoxy-N,N-dimethylpyridin-2-amine |
| SMILES | COc1cc(Br)nc(N(C)C)c1 |
| InChI | InChI=1S/C8H11BrN2O/c1-11(2)8-5-6(12-3)4-7(9)10-8/h4-5H,1-3H3 |
| InChIKey | KFDXUCUHCCXHRD-UHFFFAOYSA-N |
| XLogP | 1.92 |
| TPSA | 25.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 231.09 |
| LogP ≤ 5 | 1.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|