C13H13F6NO2 — CID 133057270
tert-butyl 2-amino-3,6-bis(trifluoromethyl)benzoate (PubChem CID 133057270) has the molecular formula C13H13F6NO2 and a molecular weight of 329.24 g/mol. Its IUPAC name is tert-butyl 2-amino-3,6-bis(trifluoromethyl)benzoate.
| Compound Name | tert-butyl 2-amino-3,6-bis(trifluoromethyl)benzoate |
|---|---|
| PubChem CID | 133057270 |
| Molecular Formula | C13H13F6NO2 |
| Molecular Weight | 329.24 g/mol |
| Exact Mass | 329.09 |
| IUPAC Name | tert-butyl 2-amino-3,6-bis(trifluoromethyl)benzoate |
| SMILES | CC(C)(C)OC(=O)c1c(C(F)(F)F)ccc(C(F)(F)F)c1N |
| InChI | InChI=1S/C13H13F6NO2/c1-11(2,3)22-10(21)8-6(12(14,15)16)4-5-7(9(8)20)13(17,18)19/h4-5H,20H2,1-3H3 |
| InChIKey | MCXPQRMGVURFCT-UHFFFAOYSA-N |
| XLogP | 4.26 |
| TPSA | 52.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.24 |
| LogP ≤ 5 | 4.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|