C9H7N3O2S — CID 133058817
methyl 4-pyrazin-2-yl-1,3-thiazole-2-carboxylate (PubChem CID 133058817) has the molecular formula C9H7N3O2S and a molecular weight of 221.24 g/mol. Its IUPAC name is methyl 4-pyrazin-2-yl-1,3-thiazole-2-carboxylate.
| Compound Name | methyl 4-pyrazin-2-yl-1,3-thiazole-2-carboxylate |
|---|---|
| PubChem CID | 133058817 |
| Molecular Formula | C9H7N3O2S |
| Molecular Weight | 221.24 g/mol |
| Exact Mass | 221.03 |
| IUPAC Name | methyl 4-pyrazin-2-yl-1,3-thiazole-2-carboxylate |
| SMILES | COC(=O)c1nc(-c2cnccn2)cs1 |
| InChI | InChI=1S/C9H7N3O2S/c1-14-9(13)8-12-7(5-15-8)6-4-10-2-3-11-6/h2-5H,1H3 |
| InChIKey | NVNGZQCZLNKXTO-UHFFFAOYSA-N |
| XLogP | 1.39 |
| TPSA | 64.97 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 221.24 |
| LogP ≤ 5 | 1.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |