C6H8N2O2 — CID 133058966
2-(aminomethyl)pyridine-3,5-diol (PubChem CID 133058966) has the molecular formula C6H8N2O2 and a molecular weight of 140.14 g/mol. Its IUPAC name is 2-(aminomethyl)pyridine-3,5-diol.
| Compound Name | 2-(aminomethyl)pyridine-3,5-diol |
|---|---|
| PubChem CID | 133058966 |
| Molecular Formula | C6H8N2O2 |
| Molecular Weight | 140.14 g/mol |
| Exact Mass | 140.06 |
| IUPAC Name | 2-(aminomethyl)pyridine-3,5-diol |
| SMILES | NCc1ncc(O)cc1O |
| InChI | InChI=1S/C6H8N2O2/c7-2-5-6(10)1-4(9)3-8-5/h1,3,9-10H,2,7H2 |
| InChIKey | HCVBXEXVGVGWFW-UHFFFAOYSA-N |
| XLogP | -0.05 |
| TPSA | 79.37 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 140.14 |
| LogP ≤ 5 | -0.05 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |