About 6-(hydroxymethyl)-5-methylpyridin-3-ol;rhodium
6-(hydroxymethyl)-5-methylpyridin-3-ol;rhodium (PubChem CID 58047449) has the molecular formula C7H9NO2Rh
and a molecular weight of 242.06 g/mol. Its IUPAC name is 6-(hydroxymethyl)-5-methylpyridin-3-ol;rhodium.
Molecular Properties
| Compound Name | 6-(hydroxymethyl)-5-methylpyridin-3-ol;rhodium |
| PubChem CID | 58047449 |
| Molecular Formula | C7H9NO2Rh |
| Molecular Weight | 242.06 g/mol |
| Exact Mass | 241.97 |
| IUPAC Name | 6-(hydroxymethyl)-5-methylpyridin-3-ol;rhodium |
| SMILES | Cc1cc(O)cnc1CO.[Rh] |
| InChI | InChI=1S/C7H9NO2.Rh/c1-5-2-6(10)3-8-7(5)4-9;/h2-3,9-10H,4H2,1H3; |
| InChIKey | OTZBQVMZFDWOQS-UHFFFAOYSA-N |
| XLogP | 0.59 |
| TPSA | 53.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 242.06 |
| LogP ≤ 5 | 0.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 6-(hydroxymethyl)-5-methylpyridin-3-ol;rhodium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-(hydroxymethyl)-5-methylpyridin-3-ol;rhodium?
The IUPAC name of 6-(hydroxymethyl)-5-methylpyridin-3-ol;rhodium (CID 58047449) is 6-(hydroxymethyl)-5-methylpyridin-3-ol;rhodium.
What is the SMILES notation for 6-(hydroxymethyl)-5-methylpyridin-3-ol;rhodium?
The canonical SMILES for 6-(hydroxymethyl)-5-methylpyridin-3-ol;rhodium is Cc1cc(O)cnc1CO.[Rh].
What is the InChIKey of 6-(hydroxymethyl)-5-methylpyridin-3-ol;rhodium?
The InChIKey is OTZBQVMZFDWOQS-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H9NO2.Rh/c1-5-2-6(10)3-8-7(5)4-9;/h2-3,9-10H,4H2,1H3;.
What are the key properties of 6-(hydroxymethyl)-5-methylpyridin-3-ol;rhodium?
6-(hydroxymethyl)-5-methylpyridin-3-ol;rhodium has a molecular weight of 242.06 g/mol, XLogP of 0.59, 1 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 6-(hydroxymethyl)-5-methylpyridin-3-ol;rhodium is sourced from PubChem (CID 58047449), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).