C7H5N3S2 — CID 133060089
5-pyrazin-2-yl-3H-1,3-thiazole-2-thione (PubChem CID 133060089) has the molecular formula C7H5N3S2 and a molecular weight of 195.27 g/mol. Its IUPAC name is 5-pyrazin-2-yl-3H-1,3-thiazole-2-thione.
| Compound Name | 5-pyrazin-2-yl-3H-1,3-thiazole-2-thione |
|---|---|
| PubChem CID | 133060089 |
| Molecular Formula | C7H5N3S2 |
| Molecular Weight | 195.27 g/mol |
| Exact Mass | 194.99 |
| IUPAC Name | 5-pyrazin-2-yl-3H-1,3-thiazole-2-thione |
| SMILES | S=c1[nH]cc(-c2cnccn2)s1 |
| InChI | InChI=1S/C7H5N3S2/c11-7-10-4-6(12-7)5-3-8-1-2-9-5/h1-4H,(H,10,11) |
| InChIKey | DIQBYBLZILERBU-UHFFFAOYSA-N |
| XLogP | 2.26 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 195.27 |
| LogP ≤ 5 | 2.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|