C8H6N4O2S — CID 175350212
(5-pyrazin-2-yl-1,3-thiazol-2-yl) carbamate (PubChem CID 175350212) has the molecular formula C8H6N4O2S and a molecular weight of 222.23 g/mol. Its IUPAC name is (5-pyrazin-2-yl-1,3-thiazol-2-yl) carbamate.
| Compound Name | (5-pyrazin-2-yl-1,3-thiazol-2-yl) carbamate |
|---|---|
| PubChem CID | 175350212 |
| Molecular Formula | C8H6N4O2S |
| Molecular Weight | 222.23 g/mol |
| Exact Mass | 222.02 |
| IUPAC Name | (5-pyrazin-2-yl-1,3-thiazol-2-yl) carbamate |
| SMILES | NC(=O)Oc1ncc(-c2cnccn2)s1 |
| InChI | InChI=1S/C8H6N4O2S/c9-7(13)14-8-12-4-6(15-8)5-3-10-1-2-11-5/h1-4H,(H2,9,13) |
| InChIKey | GFPZUWDRJMMOHC-UHFFFAOYSA-N |
| XLogP | 1.06 |
| TPSA | 90.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 222.23 |
| LogP ≤ 5 | 1.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |