About 4-methoxy-2-(2-methoxyethoxy)-N-(5-pyrazin-2-yl-1,3-thiazol-2-yl)benzamide
4-methoxy-2-(2-methoxyethoxy)-N-(5-pyrazin-2-yl-1,3-thiazol-2-yl)benzamide (PubChem CID 167771551) has the molecular formula C18H18N4O4S
and a molecular weight of 386.43 g/mol. Its IUPAC name is 4-methoxy-2-(2-methoxyethoxy)-N-(5-pyrazin-2-yl-1,3-thiazol-2-yl)benzamide.
Molecular Properties
| Compound Name | 4-methoxy-2-(2-methoxyethoxy)-N-(5-pyrazin-2-yl-1,3-thiazol-2-yl)benzamide |
| PubChem CID | 167771551 |
| Molecular Formula | C18H18N4O4S |
| Molecular Weight | 386.43 g/mol |
| Exact Mass | 386.10 |
| IUPAC Name | 4-methoxy-2-(2-methoxyethoxy)-N-(5-pyrazin-2-yl-1,3-thiazol-2-yl)benzamide |
| SMILES | COCCOc1cc(OC)ccc1C(=O)Nc1ncc(-c2cnccn2)s1 |
| InChI | InChI=1S/C18H18N4O4S/c1-24-7-8-26-15-9-12(25-2)3-4-13(15)17(23)22-18-21-11-16(27-18)14-10-19-5-6-20-14/h3-6,9-11H,7-8H2,1-2H3,(H,21,22,23) |
| InChIKey | UDKRDGJCHRHGHJ-UHFFFAOYSA-N |
| XLogP | 2.89 |
| TPSA | 95.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 386.43 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 4-methoxy-2-(2-methoxyethoxy)-N-(5-pyrazin-2-yl-1,3-thiazol-2-yl)benzamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-methoxy-2-(2-methoxyethoxy)-N-(5-pyrazin-2-yl-1,3-thiazol-2-yl)benzamide?
The IUPAC name of 4-methoxy-2-(2-methoxyethoxy)-N-(5-pyrazin-2-yl-1,3-thiazol-2-yl)benzamide (CID 167771551) is 4-methoxy-2-(2-methoxyethoxy)-N-(5-pyrazin-2-yl-1,3-thiazol-2-yl)benzamide.
What is the SMILES notation for 4-methoxy-2-(2-methoxyethoxy)-N-(5-pyrazin-2-yl-1,3-thiazol-2-yl)benzamide?
The canonical SMILES for 4-methoxy-2-(2-methoxyethoxy)-N-(5-pyrazin-2-yl-1,3-thiazol-2-yl)benzamide is COCCOc1cc(OC)ccc1C(=O)Nc1ncc(-c2cnccn2)s1.
What is the InChIKey of 4-methoxy-2-(2-methoxyethoxy)-N-(5-pyrazin-2-yl-1,3-thiazol-2-yl)benzamide?
The InChIKey is UDKRDGJCHRHGHJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H18N4O4S/c1-24-7-8-26-15-9-12(25-2)3-4-13(15)17(23)22-18-21-11-16(27-18)14-10-19-5-6-20-14/h3-6,9-11H,7-8H2,1-2H3,(H,21,22,23).
What are the key properties of 4-methoxy-2-(2-methoxyethoxy)-N-(5-pyrazin-2-yl-1,3-thiazol-2-yl)benzamide?
4-methoxy-2-(2-methoxyethoxy)-N-(5-pyrazin-2-yl-1,3-thiazol-2-yl)benzamide has a molecular weight of 386.43 g/mol, XLogP of 2.89, 8 rotatable bonds, 1 hydrogen bond donors, and 8 hydrogen bond acceptors.
Where does this data come from?
All data for 4-methoxy-2-(2-methoxyethoxy)-N-(5-pyrazin-2-yl-1,3-thiazol-2-yl)benzamide is sourced from PubChem (CID 167771551), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).