C7H6IN3O — CID 133061798
(8-iodo-[1,2,4]triazolo[1,5-a]pyridin-2-yl)methanol (PubChem CID 133061798) has the molecular formula C7H6IN3O and a molecular weight of 275.05 g/mol. Its IUPAC name is (8-iodo-[1,2,4]triazolo[1,5-a]pyridin-2-yl)methanol.
| Compound Name | (8-iodo-[1,2,4]triazolo[1,5-a]pyridin-2-yl)methanol |
|---|---|
| PubChem CID | 133061798 |
| Molecular Formula | C7H6IN3O |
| Molecular Weight | 275.05 g/mol |
| Exact Mass | 274.96 |
| IUPAC Name | (8-iodo-[1,2,4]triazolo[1,5-a]pyridin-2-yl)methanol |
| SMILES | OCc1nc2c(I)cccn2n1 |
| InChI | InChI=1S/C7H6IN3O/c8-5-2-1-3-11-7(5)9-6(4-12)10-11/h1-3,12H,4H2 |
| InChIKey | DHEPDUOTIZTUPM-UHFFFAOYSA-N |
| XLogP | 0.83 |
| TPSA | 50.42 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.05 |
| LogP ≤ 5 | 0.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|