C14H17FO2 — CID 133063442
8-(2-fluorophenyl)-1,4-dioxaspiro[4.5]decane (PubChem CID 133063442) has the molecular formula C14H17FO2 and a molecular weight of 236.29 g/mol. Its IUPAC name is 8-(2-fluorophenyl)-1,4-dioxaspiro[4.5]decane.
| Compound Name | 8-(2-fluorophenyl)-1,4-dioxaspiro[4.5]decane |
|---|---|
| PubChem CID | 133063442 |
| Molecular Formula | C14H17FO2 |
| Molecular Weight | 236.29 g/mol |
| Exact Mass | 236.12 |
| IUPAC Name | 8-(2-fluorophenyl)-1,4-dioxaspiro[4.5]decane |
| SMILES | Fc1ccccc1C1CCC2(CC1)OCCO2 |
| InChI | InChI=1S/C14H17FO2/c15-13-4-2-1-3-12(13)11-5-7-14(8-6-11)16-9-10-17-14/h1-4,11H,5-10H2 |
| InChIKey | CLNUJNAWGKQGED-UHFFFAOYSA-N |
| XLogP | 3.23 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 236.29 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |