C19H16N4O2 — CID 133064048
3,3,4-tricyano-2-phenyl-5,6,7,8-tetrahydro-2H-chromene-4-carboxamide (PubChem CID 133064048) has the molecular formula C19H16N4O2 and a molecular weight of 332.36 g/mol. Its IUPAC name is 3,3,4-tricyano-2-phenyl-5,6,7,8-tetrahydro-2H-chromene-4-carboxamide.
| Compound Name | 3,3,4-tricyano-2-phenyl-5,6,7,8-tetrahydro-2H-chromene-4-carboxamide |
|---|---|
| PubChem CID | 133064048 |
| Molecular Formula | C19H16N4O2 |
| Molecular Weight | 332.36 g/mol |
| Exact Mass | 332.13 |
| IUPAC Name | 3,3,4-tricyano-2-phenyl-5,6,7,8-tetrahydro-2H-chromene-4-carboxamide |
| SMILES | N#CC1(C(N)=O)C2=C(CCCC2)OC(c2ccccc2)C1(C#N)C#N |
| InChI | InChI=1S/C19H16N4O2/c20-10-18(11-21)16(13-6-2-1-3-7-13)25-15-9-5-4-8-14(15)19(18,12-22)17(23)24/h1-3,6-7,16H,4-5,8-9H2,(H2,23,24) |
| InChIKey | BUQHCOGNILIIHE-UHFFFAOYSA-N |
| XLogP | 2.61 |
| TPSA | 123.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.36 |
| LogP ≤ 5 | 2.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |